C18H14ClN5O2S — CID 171333053
3-[1-(3-chloro-4-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 171333053) has the molecular formula C18H14ClN5O2S and a molecular weight of 399.86 g/mol. Its IUPAC name is 3-[1-(3-chloro-4-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[1-(3-chloro-4-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333053 |
| Molecular Formula | C18H14ClN5O2S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 3-[1-(3-chloro-4-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(-n2cccc2C=C(C#N)C(=O)Nc2nnc(C)s2)cc1Cl |
| InChI | InChI=1S/C18H14ClN5O2S/c1-11-22-23-18(27-11)21-17(25)12(10-20)8-13-4-3-7-24(13)14-5-6-16(26-2)15(19)9-14/h3-9H,1-2H3,(H,21,23,25) |
| InChIKey | RHNZGOLFJOCWJM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|