C19H15ClN6O3S — CID 170915500
(Z)-3-[1-(4-chloro-3-nitrophenyl)pyrrol-2-yl]-2-cyano-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170915500) has the molecular formula C19H15ClN6O3S and a molecular weight of 442.89 g/mol. Its IUPAC name is (Z)-3-[1-(4-chloro-3-nitrophenyl)pyrrol-2-yl]-2-cyano-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[1-(4-chloro-3-nitrophenyl)pyrrol-2-yl]-2-cyano-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170915500 |
| Molecular Formula | C19H15ClN6O3S |
| Molecular Weight | 442.89 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (Z)-3-[1-(4-chloro-3-nitrophenyl)pyrrol-2-yl]-2-cyano-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CC(C)c1nnc(NC(=O)/C(C#N)=C\c2cccn2-c2ccc(Cl)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C19H15ClN6O3S/c1-11(2)18-23-24-19(30-18)22-17(27)12(10-21)8-13-4-3-7-25(13)14-5-6-15(20)16(9-14)26(28)29/h3-9,11H,1-2H3,(H,22,24,27)/b12-8- |
| InChIKey | DZQPEPOXPKVGOX-WQLSENKSSA-N |
| XLogP | 4.56 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|