C26H24N6O3S — CID 171333178
N-[5-(1-adamantyl)-1,3,4-thiadiazol-2-yl]-2-cyano-3-[1-(3-nitrophenyl)pyrrol-2-yl]prop-2-enamide (PubChem CID 171333178) has the molecular formula C26H24N6O3S and a molecular weight of 500.58 g/mol. Its IUPAC name is N-[5-(1-adamantyl)-1,3,4-thiadiazol-2-yl]-2-cyano-3-[1-(3-nitrophenyl)pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-[5-(1-adamantyl)-1,3,4-thiadiazol-2-yl]-2-cyano-3-[1-(3-nitrophenyl)pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171333178 |
| Molecular Formula | C26H24N6O3S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | N-[5-(1-adamantyl)-1,3,4-thiadiazol-2-yl]-2-cyano-3-[1-(3-nitrophenyl)pyrrol-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1cccn1-c1cccc([N+](=O)[O-])c1)C(=O)Nc1nnc(C23CC4CC(CC(C4)C2)C3)s1 |
| InChI | InChI=1S/C26H24N6O3S/c27-15-19(10-20-5-2-6-31(20)21-3-1-4-22(11-21)32(34)35)23(33)28-25-30-29-24(36-25)26-12-16-7-17(13-26)9-18(8-16)14-26/h1-6,10-11,16-18H,7-9,12-14H2,(H,28,30,33) |
| InChIKey | OVPDBHGMPWUPLP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|