C23H17N5O3S — CID 21382742
(E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[1-(3-nitrophenyl)pyrrol-2-yl]prop-2-enamide (PubChem CID 21382742) has the molecular formula C23H17N5O3S and a molecular weight of 443.49 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[1-(3-nitrophenyl)pyrrol-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[1-(3-nitrophenyl)pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 21382742 |
| Molecular Formula | C23H17N5O3S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | (E)-2-cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[1-(3-nitrophenyl)pyrrol-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cccn1-c1cccc([N+](=O)[O-])c1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C23H17N5O3S/c24-13-15(22(29)26-23-20(14-25)19-8-1-2-9-21(19)32-23)11-16-7-4-10-27(16)17-5-3-6-18(12-17)28(30)31/h3-7,10-12H,1-2,8-9H2,(H,26,29)/b15-11+ |
| InChIKey | XGZLPNSNLWXOJL-RVDMUPIBSA-N |
| XLogP | 4.74 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|