C13H11BrFNO — CID 107600600
1-(2-bromo-6-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 107600600) has the molecular formula C13H11BrFNO and a molecular weight of 296.14 g/mol. Its IUPAC name is 1-(2-bromo-6-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde.
| Compound Name | 1-(2-bromo-6-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 107600600 |
| Molecular Formula | C13H11BrFNO |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 1-(2-bromo-6-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | Cc1cc(C=O)c(C)n1-c1c(F)cccc1Br |
| InChI | InChI=1S/C13H11BrFNO/c1-8-6-10(7-17)9(2)16(8)13-11(14)4-3-5-12(13)15/h3-7H,1-2H3 |
| InChIKey | GTLTXKJQHRTMQZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|