C14H12NO3- — CID 7324929
3-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 7324929) has the molecular formula C14H12NO3- and a molecular weight of 242.25 g/mol. Its IUPAC name is 3-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | 3-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 7324929 |
| Molecular Formula | C14H12NO3- |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1cc(C=O)c(C)n1-c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C14H13NO3/c1-9-6-12(8-16)10(2)15(9)13-5-3-4-11(7-13)14(17)18/h3-8H,1-2H3,(H,17,18)/p-1 |
| InChIKey | NSUJXPAWDKAXDQ-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 62.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|