C19H13N3O7-2 — CID 2278798
5-[2,5-dimethyl-3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 2278798) has the molecular formula C19H13N3O7-2 and a molecular weight of 395.33 g/mol. Its IUPAC name is 5-[2,5-dimethyl-3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | 5-[2,5-dimethyl-3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2278798 |
| Molecular Formula | C19H13N3O7-2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 5-[2,5-dimethyl-3-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | Cc1cc(C=C2C(=O)NC(=O)NC2=O)c(C)n1-c1cc(C(=O)[O-])cc(C(=O)[O-])c1 |
| InChI | InChI=1S/C19H15N3O7/c1-8-3-10(7-14-15(23)20-19(29)21-16(14)24)9(2)22(8)13-5-11(17(25)26)4-12(6-13)18(27)28/h3-7H,1-2H3,(H,25,26)(H,27,28)(H2,20,21,23,24,29)/p-2 |
| InChIKey | JWOONVORUXINDG-UHFFFAOYSA-L |
| XLogP | -1.43 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|