C20H17N3O5S-2 — CID 7326424
5-[2,5-dimethyl-3-[(E)-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 7326424) has the molecular formula C20H17N3O5S-2 and a molecular weight of 411.44 g/mol. Its IUPAC name is 5-[2,5-dimethyl-3-[(E)-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | 5-[2,5-dimethyl-3-[(E)-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7326424 |
| Molecular Formula | C20H17N3O5S-2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 5-[2,5-dimethyl-3-[(E)-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | C/N=C1\S/C(=C/c2cc(C)n(-c3cc(C(=O)[O-])cc(C(=O)[O-])c3)c2C)C(=O)N1C |
| InChI | InChI=1S/C20H19N3O5S/c1-10-5-12(9-16-17(24)22(4)20(21-3)29-16)11(2)23(10)15-7-13(18(25)26)6-14(8-15)19(27)28/h5-9H,1-4H3,(H,25,26)(H,27,28)/p-2/b16-9+,21-20- |
| InChIKey | CRQNNMHKXZCYER-SEOIAPGZSA-L |
| XLogP | 0.35 |
| TPSA | 117.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|