C19H20FN3OS — CID 57397320
(5Z)-5-[[1-[(2-fluorophenyl)methyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 57397320) has the molecular formula C19H20FN3OS and a molecular weight of 357.45 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2-fluorophenyl)methyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(2-fluorophenyl)methyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 57397320 |
| Molecular Formula | C19H20FN3OS |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (5Z)-5-[[1-[(2-fluorophenyl)methyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-methyl-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1/S/C(=C\c2cc(C)n(Cc3ccccc3F)c2C)C(=O)N1C |
| InChI | InChI=1S/C19H20FN3OS/c1-12-9-15(10-17-18(24)22(4)19(21-3)25-17)13(2)23(12)11-14-7-5-6-8-16(14)20/h5-10H,11H2,1-4H3/b17-10-,21-19+ |
| InChIKey | CBCXZCNKPLLTKW-PZDISWOBSA-N |
| XLogP | 3.82 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|