C30H26FN3O3S — CID 4237455
ethyl 3-[[5-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4237455) has the molecular formula C30H26FN3O3S and a molecular weight of 527.62 g/mol. Its IUPAC name is ethyl 3-[[5-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[5-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4237455 |
| Molecular Formula | C30H26FN3O3S |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | ethyl 3-[[5-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C2/SC(=Cc3c(C)n(Cc4ccccc4F)c4ccccc34)C(=O)N2C)c1 |
| InChI | InChI=1S/C30H26FN3O3S/c1-4-37-29(36)20-11-9-12-22(16-20)32-30-33(3)28(35)27(38-30)17-24-19(2)34(26-15-8-6-13-23(24)26)18-21-10-5-7-14-25(21)31/h5-17H,4,18H2,1-3H3/b27-17?,32-30+ |
| InChIKey | YHZPHUWEKPOESI-LLDHBRIYSA-N |
| XLogP | 6.55 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|