C22H18ClN3O3S — CID 1233250
2-[3-[(E)-[2-(4-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetic acid (PubChem CID 1233250) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is 2-[3-[(E)-[2-(4-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-[2-(4-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 1233250 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-[3-[(E)-[2-(4-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(/C=C2/S/C(=N\c3ccc(Cl)cc3)N(C)C2=O)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C22H18ClN3O3S/c1-13-17(16-5-3-4-6-18(16)26(13)12-20(27)28)11-19-21(29)25(2)22(30-19)24-15-9-7-14(23)8-10-15/h3-11H,12H2,1-2H3,(H,27,28)/b19-11+,24-22- |
| InChIKey | LFBLIOFDCJZQGI-MSBDOUPJSA-N |
| XLogP | 4.92 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|