C24H21BrClN3O3S — CID 126018921
ethyl 2-[3-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetate (PubChem CID 126018921) has the molecular formula C24H21BrClN3O3S and a molecular weight of 546.87 g/mol. Its IUPAC name is ethyl 2-[3-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 126018921 |
| Molecular Formula | C24H21BrClN3O3S |
| Molecular Weight | 546.87 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | ethyl 2-[3-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(/C=C2/S/C(=N\c3ccc(Br)c(Cl)c3)N(C)C2=O)c2ccccc21 |
| InChI | InChI=1S/C24H21BrClN3O3S/c1-4-32-22(30)13-29-14(2)17(16-7-5-6-8-20(16)29)12-21-23(31)28(3)24(33-21)27-15-9-10-18(25)19(26)11-15/h5-12H,4,13H2,1-3H3/b21-12+,27-24- |
| InChIKey | QOBJYAOENDEZLK-ISHFRVPGSA-N |
| XLogP | 6.16 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.87 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|