C26H17BrCl3N3OS — CID 126020412
(5E)-2-(4-bromo-3-chlorophenyl)imino-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-methyl-1,3-thiazolidin-4-one (PubChem CID 126020412) has the molecular formula C26H17BrCl3N3OS and a molecular weight of 605.77 g/mol. Its IUPAC name is (5E)-2-(4-bromo-3-chlorophenyl)imino-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-bromo-3-chlorophenyl)imino-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126020412 |
| Molecular Formula | C26H17BrCl3N3OS |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 602.93 |
| IUPAC Name | (5E)-2-(4-bromo-3-chlorophenyl)imino-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-methyl-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)S/C1=N\c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C26H17BrCl3N3OS/c1-32-25(34)24(35-26(32)31-17-7-8-19(27)21(29)12-17)11-16-14-33(23-5-3-2-4-18(16)23)13-15-6-9-20(28)22(30)10-15/h2-12,14H,13H2,1H3/b24-11+,31-26- |
| InChIKey | WCFQOXJWJHJAAT-RFVNABESSA-N |
| XLogP | 8.65 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|