C28H26N4O4S — CID 86206579
N-(furan-2-ylmethyl)-2-[3-[(Z)-[2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetamide (PubChem CID 86206579) has the molecular formula C28H26N4O4S and a molecular weight of 514.61 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[3-[(Z)-[2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[3-[(Z)-[2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetamide |
|---|---|
| PubChem CID | 86206579 |
| Molecular Formula | C28H26N4O4S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[3-[(Z)-[2-(4-methoxyphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]acetamide |
| SMILES | COc1ccc(/N=C2/S/C(=C\c3c(C)n(CC(=O)NCc4ccco4)c4ccccc34)C(=O)N2C)cc1 |
| InChI | InChI=1S/C28H26N4O4S/c1-18-23(15-25-27(34)31(2)28(37-25)30-19-10-12-20(35-3)13-11-19)22-8-4-5-9-24(22)32(18)17-26(33)29-16-21-7-6-14-36-21/h4-15H,16-17H2,1-3H3,(H,29,33)/b25-15-,30-28+ |
| InChIKey | QIKBALAVCGGLNF-UNAWRRCPSA-N |
| XLogP | 5.10 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|