C30H24N4O3S — CID 4290128
ethyl 3-[[5-[[1-[(2-cyanophenyl)methyl]indol-3-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4290128) has the molecular formula C30H24N4O3S and a molecular weight of 520.61 g/mol. Its IUPAC name is ethyl 3-[[5-[[1-[(2-cyanophenyl)methyl]indol-3-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[5-[[1-[(2-cyanophenyl)methyl]indol-3-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4290128 |
| Molecular Formula | C30H24N4O3S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | ethyl 3-[[5-[[1-[(2-cyanophenyl)methyl]indol-3-yl]methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C2/SC(=Cc3cn(Cc4ccccc4C#N)c4ccccc34)C(=O)N2C)c1 |
| InChI | InChI=1S/C30H24N4O3S/c1-3-37-29(36)20-11-8-12-24(15-20)32-30-33(2)28(35)27(38-30)16-23-19-34(26-14-7-6-13-25(23)26)18-22-10-5-4-9-21(22)17-31/h4-16,19H,3,18H2,1-2H3/b27-16?,32-30+ |
| InChIKey | IDANLAJDDGQWPB-SNFJYIEESA-N |
| XLogP | 5.97 |
| TPSA | 87.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|