C20H16BrN2O2- — CID 6979232
3-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoate (PubChem CID 6979232) has the molecular formula C20H16BrN2O2- and a molecular weight of 396.26 g/mol. Its IUPAC name is 3-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoate.
| Compound Name | 3-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 6979232 |
| Molecular Formula | C20H16BrN2O2- |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 3-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoate |
| SMILES | Cc1cc(/C=N/c2cccc(C(=O)[O-])c2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H17BrN2O2/c1-13-10-16(12-22-18-5-3-4-15(11-18)20(24)25)14(2)23(13)19-8-6-17(21)7-9-19/h3-12H,1-2H3,(H,24,25)/p-1/b22-12+ |
| InChIKey | UQLMQNKMWQRKNG-WSDLNYQXSA-M |
| XLogP | 3.97 |
| TPSA | 57.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|