C21H21N3O4S — CID 25040336
methyl 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]benzoate (PubChem CID 25040336) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is methyl 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]benzoate.
| Compound Name | methyl 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 25040336 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | methyl 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]benzoate |
| SMILES | COC(=O)c1cccc(/N=C/c2cc(C)n(-c3ccc(S(N)(=O)=O)cc3)c2C)c1 |
| InChI | InChI=1S/C21H21N3O4S/c1-14-11-17(13-23-18-6-4-5-16(12-18)21(25)28-3)15(2)24(14)19-7-9-20(10-8-19)29(22,26)27/h4-13H,1-3H3,(H2,22,26,27)/b23-13+ |
| InChIKey | MMMXCBKECKHKHS-YDZHTSKRSA-N |
| XLogP | 3.28 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|