C20H20ClN3O2S — CID 25041426
4-[3-[(5-chloro-2-methylphenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide (PubChem CID 25041426) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 4-[3-[(5-chloro-2-methylphenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[(5-chloro-2-methylphenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25041426 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4-[3-[(5-chloro-2-methylphenyl)iminomethyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1/N=C/c1cc(C)n(-c2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C20H20ClN3O2S/c1-13-4-5-17(21)11-20(13)23-12-16-10-14(2)24(15(16)3)18-6-8-19(9-7-18)27(22,25)26/h4-12H,1-3H3,(H2,22,25,26)/b23-12+ |
| InChIKey | ZVLGSTCCUFXAAI-FSJBWODESA-N |
| XLogP | 4.45 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|