C20H19IN2 — CID 3108862
1-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-methylphenyl)methanimine (PubChem CID 3108862) has the molecular formula C20H19IN2 and a molecular weight of 414.29 g/mol. Its IUPAC name is 1-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-methylphenyl)methanimine.
| Compound Name | 1-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 3108862 |
| Molecular Formula | C20H19IN2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]-N-(2-methylphenyl)methanimine |
| SMILES | Cc1ccccc1/N=C/c1cc(C)n(-c2ccc(I)cc2)c1C |
| InChI | InChI=1S/C20H19IN2/c1-14-6-4-5-7-20(14)22-13-17-12-15(2)23(16(17)3)19-10-8-18(21)9-11-19/h4-13H,1-3H3/b22-13+ |
| InChIKey | YFLWRQAYGPEVOD-LPYMAVHISA-N |
| XLogP | 5.76 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|