C21H22N2OS — CID 126193394
2-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzenethiol (PubChem CID 126193394) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzenethiol.
| Compound Name | 2-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzenethiol |
|---|---|
| PubChem CID | 126193394 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzenethiol |
| SMILES | CCOc1ccc(-n2c(C)cc(/C=N/c3ccccc3S)c2C)cc1 |
| InChI | InChI=1S/C21H22N2OS/c1-4-24-19-11-9-18(10-12-19)23-15(2)13-17(16(23)3)14-22-20-7-5-6-8-21(20)25/h5-14,25H,4H2,1-3H3/b22-14+ |
| InChIKey | MSUSFDAQITWXLC-HYARGMPZSA-N |
| XLogP | 5.53 |
| TPSA | 26.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|