C31H27N3O4 — CID 126192956
5-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126192956) has the molecular formula C31H27N3O4 and a molecular weight of 505.57 g/mol. Its IUPAC name is 5-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126192956 |
| Molecular Formula | C31H27N3O4 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 5-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccc(-n2c(C)cc(C=C3C(=O)N(c4ccccc4)C(=O)N(c4ccccc4)C3=O)c2C)cc1 |
| InChI | InChI=1S/C31H27N3O4/c1-4-38-27-17-15-26(16-18-27)32-21(2)19-23(22(32)3)20-28-29(35)33(24-11-7-5-8-12-24)31(37)34(30(28)36)25-13-9-6-10-14-25/h5-20H,4H2,1-3H3 |
| InChIKey | GTCFJGGFKILBJS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|