C32H29N3O4 — CID 126027546
(5E)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-1-(2-methoxyethyl)-3-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126027546) has the molecular formula C32H29N3O4 and a molecular weight of 519.60 g/mol. Its IUPAC name is (5E)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-1-(2-methoxyethyl)-3-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-1-(2-methoxyethyl)-3-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126027546 |
| Molecular Formula | C32H29N3O4 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | (5E)-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-1-(2-methoxyethyl)-3-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | COCCN1C(=O)/C(=C\c2cc(C)n(-c3ccc(-c4ccccc4)cc3)c2C)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C32H29N3O4/c1-22-20-26(23(2)34(22)28-16-14-25(15-17-28)24-10-6-4-7-11-24)21-29-30(36)33(18-19-39-3)32(38)35(31(29)37)27-12-8-5-9-13-27/h4-17,20-21H,18-19H2,1-3H3/b29-21+ |
| InChIKey | WHFIMWXNUPTDMM-XHLNEMQHSA-N |
| XLogP | 5.79 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|