C22H21BrN2O6 — CID 126015342
(5Z)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-1-(2-methoxyethyl)-3-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126015342) has the molecular formula C22H21BrN2O6 and a molecular weight of 489.32 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-1-(2-methoxyethyl)-3-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-1-(2-methoxyethyl)-3-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126015342 |
| Molecular Formula | C22H21BrN2O6 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | (5Z)-5-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-1-(2-methoxyethyl)-3-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | COCCN1C(=O)/C(=C/c2cc(OC)c(OC)cc2Br)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H21BrN2O6/c1-29-10-9-24-20(26)16(11-14-12-18(30-2)19(31-3)13-17(14)23)21(27)25(22(24)28)15-7-5-4-6-8-15/h4-8,11-13H,9-10H2,1-3H3/b16-11- |
| InChIKey | FAYWDMOAYIQFST-WJDWOHSUSA-N |
| XLogP | 3.49 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|