C35H37N3O4 — CID 126192889
(5E)-1-[4-(1-adamantyl)phenyl]-5-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126192889) has the molecular formula C35H37N3O4 and a molecular weight of 563.70 g/mol. Its IUPAC name is (5E)-1-[4-(1-adamantyl)phenyl]-5-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-[4-(1-adamantyl)phenyl]-5-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126192889 |
| Molecular Formula | C35H37N3O4 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | (5E)-1-[4-(1-adamantyl)phenyl]-5-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccc(-n2c(C)cc(/C=C3\C(=O)NC(=O)N(c4ccc(C56CC7CC(CC(C7)C5)C6)cc4)C3=O)c2C)cc1 |
| InChI | InChI=1S/C35H37N3O4/c1-4-42-30-11-9-28(10-12-30)37-21(2)13-26(22(37)3)17-31-32(39)36-34(41)38(33(31)40)29-7-5-27(6-8-29)35-18-23-14-24(19-35)16-25(15-23)20-35/h5-13,17,23-25H,4,14-16,18-20H2,1-3H3,(H,36,39,41)/b31-17+ |
| InChIKey | FVPHZALFKHABIM-KBVAKVRCSA-N |
| XLogP | 6.63 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|