C30H30N2O4 — CID 6084126
(5E)-1-[4-(1-adamantyl)phenyl]-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 6084126) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is (5E)-1-[4-(1-adamantyl)phenyl]-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-[4-(1-adamantyl)phenyl]-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6084126 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (5E)-1-[4-(1-adamantyl)phenyl]-5-[(4-prop-2-enoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCOc1ccc(/C=C2\C(=O)NC(=O)N(c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H30N2O4/c1-2-11-36-25-9-3-19(4-10-25)15-26-27(33)31-29(35)32(28(26)34)24-7-5-23(6-8-24)30-16-20-12-21(17-30)14-22(13-20)18-30/h2-10,15,20-22H,1,11-14,16-18H2,(H,31,33,35)/b26-15+ |
| InChIKey | KUODCGBGKOTHDX-CVKSISIWSA-N |
| XLogP | 5.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|