C33H37BrN2O5 — CID 124532070
(5E)-1-[4-(1-adamantyl)phenyl]-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 124532070) has the molecular formula C33H37BrN2O5 and a molecular weight of 621.57 g/mol. Its IUPAC name is (5E)-1-[4-(1-adamantyl)phenyl]-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-[4-(1-adamantyl)phenyl]-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124532070 |
| Molecular Formula | C33H37BrN2O5 |
| Molecular Weight | 621.57 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | (5E)-1-[4-(1-adamantyl)phenyl]-5-[[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)C2=O)cc(Br)c1O[C@@H](C)CC |
| InChI | InChI=1S/C33H37BrN2O5/c1-4-19(3)41-29-27(34)14-20(15-28(29)40-5-2)13-26-30(37)35-32(39)36(31(26)38)25-8-6-24(7-9-25)33-16-21-10-22(17-33)12-23(11-21)18-33/h6-9,13-15,19,21-23H,4-5,10-12,16-18H2,1-3H3,(H,35,37,39)/b26-13+/t19-,21?,22?,23?,33?/m0/s1 |
| InChIKey | QAIZEYZXLJBPHE-ULILXGBTSA-N |
| XLogP | 7.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|