C29H26N2O2 — CID 126204496
(3E)-3-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylindol-2-one (PubChem CID 126204496) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is (3E)-3-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylindol-2-one.
| Compound Name | (3E)-3-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylindol-2-one |
|---|---|
| PubChem CID | 126204496 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (3E)-3-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylindol-2-one |
| SMILES | CCOc1ccc(-n2c(C)cc(/C=C3/C(=O)N(c4ccccc4)c4ccccc43)c2C)cc1 |
| InChI | InChI=1S/C29H26N2O2/c1-4-33-25-16-14-24(15-17-25)30-20(2)18-22(21(30)3)19-27-26-12-8-9-13-28(26)31(29(27)32)23-10-6-5-7-11-23/h5-19H,4H2,1-3H3/b27-19+ |
| InChIKey | BJAFNOPRVJQDNU-ZXVVBBHZSA-N |
| XLogP | 6.71 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|