C33H32N4O3 — CID 126205074
(3E)-3-[[1-[4-(cyclohexylamino)-3-nitrophenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylindol-2-one (PubChem CID 126205074) has the molecular formula C33H32N4O3 and a molecular weight of 532.64 g/mol. Its IUPAC name is (3E)-3-[[1-[4-(cyclohexylamino)-3-nitrophenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylindol-2-one.
| Compound Name | (3E)-3-[[1-[4-(cyclohexylamino)-3-nitrophenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylindol-2-one |
|---|---|
| PubChem CID | 126205074 |
| Molecular Formula | C33H32N4O3 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | (3E)-3-[[1-[4-(cyclohexylamino)-3-nitrophenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylindol-2-one |
| SMILES | Cc1cc(/C=C2/C(=O)N(c3ccccc3)c3ccccc32)c(C)n1-c1ccc(NC2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H32N4O3/c1-22-19-24(20-29-28-15-9-10-16-31(28)36(33(29)38)26-13-7-4-8-14-26)23(2)35(22)27-17-18-30(32(21-27)37(39)40)34-25-11-5-3-6-12-25/h4,7-10,13-21,25,34H,3,5-6,11-12H2,1-2H3/b29-20+ |
| InChIKey | FXWGAZNCUKZVNF-ZTKZIYFRSA-N |
| XLogP | 7.97 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|