C18H23N3O2 — CID 2894670
N-cyclohexyl-4-(2,5-dimethylpyrrol-1-yl)-2-nitroaniline (PubChem CID 2894670) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,5-dimethylpyrrol-1-yl)-2-nitroaniline.
| Compound Name | N-cyclohexyl-4-(2,5-dimethylpyrrol-1-yl)-2-nitroaniline |
|---|---|
| PubChem CID | 2894670 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-cyclohexyl-4-(2,5-dimethylpyrrol-1-yl)-2-nitroaniline |
| SMILES | Cc1ccc(C)n1-c1ccc(NC2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H23N3O2/c1-13-8-9-14(2)20(13)16-10-11-17(18(12-16)21(22)23)19-15-6-4-3-5-7-15/h8-12,15,19H,3-7H2,1-2H3 |
| InChIKey | VYDFIIOOMSNSRI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|