C26H26N2O3 — CID 126204039
ethyl 4-[3-[(E)-(1-ethyl-2-oxoindol-3-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 126204039) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is ethyl 4-[3-[(E)-(1-ethyl-2-oxoindol-3-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(E)-(1-ethyl-2-oxoindol-3-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 126204039 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | ethyl 4-[3-[(E)-(1-ethyl-2-oxoindol-3-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)cc(/C=C3/C(=O)N(CC)c4ccccc43)c2C)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-5-27-24-10-8-7-9-22(24)23(25(27)29)16-20-15-17(3)28(18(20)4)21-13-11-19(12-14-21)26(30)31-6-2/h7-16H,5-6H2,1-4H3/b23-16+ |
| InChIKey | PLDZNQKDTLTRRL-XQNSMLJCSA-N |
| XLogP | 5.18 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|