C30H33N3O4 — CID 166973029
ethyl 4-[3-[(Z)-(1-benzyl-2-butyl-3,5-dioxopyrazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 166973029) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is ethyl 4-[3-[(Z)-(1-benzyl-2-butyl-3,5-dioxopyrazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(Z)-(1-benzyl-2-butyl-3,5-dioxopyrazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 166973029 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | ethyl 4-[3-[(Z)-(1-benzyl-2-butyl-3,5-dioxopyrazolidin-4-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCCCN1C(=O)/C(=C/c2cc(C)n(-c3ccc(C(=O)OCC)cc3)c2C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H33N3O4/c1-5-7-17-31-28(34)27(29(35)32(31)20-23-11-9-8-10-12-23)19-25-18-21(3)33(22(25)4)26-15-13-24(14-16-26)30(36)37-6-2/h8-16,18-19H,5-7,17,20H2,1-4H3/b27-19- |
| InChIKey | NYXMDGOWKLMFRV-DIBXZPPDSA-N |
| XLogP | 5.24 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|