C25H30N2O4S — CID 126137289
butyl 4-[3-[(Z)-(3-butyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 126137289) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is butyl 4-[3-[(Z)-(3-butyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | butyl 4-[3-[(Z)-(3-butyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 126137289 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | butyl 4-[3-[(Z)-(3-butyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-n2c(C)cc(/C=C3\SC(=O)N(CCCC)C3=O)c2C)cc1 |
| InChI | InChI=1S/C25H30N2O4S/c1-5-7-13-26-23(28)22(32-25(26)30)16-20-15-17(3)27(18(20)4)21-11-9-19(10-12-21)24(29)31-14-8-6-2/h9-12,15-16H,5-8,13-14H2,1-4H3/b22-16- |
| InChIKey | OSTGFGLRKWAUMK-JWGURIENSA-N |
| XLogP | 5.89 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|