C18H21NO3 — CID 2280392
butyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 2280392) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is butyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | butyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 2280392 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | butyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | CCCCOC(=O)c1ccc(-n2c(C)cc(C=O)c2C)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-4-5-10-22-18(21)15-6-8-17(9-7-15)19-13(2)11-16(12-20)14(19)3/h6-9,11-12H,4-5,10H2,1-3H3 |
| InChIKey | SITCKXPTYJEMPV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|