C19H17N3O2 — CID 775554
ethyl 4-[3-(2,2-dicyanoethenyl)-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 775554) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 4-[3-(2,2-dicyanoethenyl)-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-(2,2-dicyanoethenyl)-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 775554 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | ethyl 4-[3-(2,2-dicyanoethenyl)-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)cc(C=C(C#N)C#N)c2C)cc1 |
| InChI | InChI=1S/C19H17N3O2/c1-4-24-19(23)16-5-7-18(8-6-16)22-13(2)9-17(14(22)3)10-15(11-20)12-21/h5-10H,4H2,1-3H3 |
| InChIKey | UTFWZCJKAINQSB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|