C17H22N5O2+ — CID 135754970
(E)-(diaminomethylideneamino)-[[1-(4-ethoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]azanium (PubChem CID 135754970) has the molecular formula C17H22N5O2+ and a molecular weight of 328.40 g/mol. Its IUPAC name is (E)-(diaminomethylideneamino)-[[1-(4-ethoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]azanium.
| Compound Name | (E)-(diaminomethylideneamino)-[[1-(4-ethoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]azanium |
|---|---|
| PubChem CID | 135754970 |
| Molecular Formula | C17H22N5O2+ |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (E)-(diaminomethylideneamino)-[[1-(4-ethoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]azanium |
| SMILES | CCOC(=O)c1ccc(-n2c(C)cc(/C=[NH+]/N=C(N)N)c2C)cc1 |
| InChI | InChI=1S/C17H21N5O2/c1-4-24-16(23)13-5-7-15(8-6-13)22-11(2)9-14(12(22)3)10-20-21-17(18)19/h5-10H,4H2,1-3H3,(H4,18,19,21)/p+1/b20-10+ |
| InChIKey | GMXMKCWUDUAZJC-KEBDBYFISA-O |
| XLogP | -0.04 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|