C20H22N6O3 — CID 135847271
ethyl 4-[2,5-dimethyl-3-[(Z)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]pyrrol-1-yl]benzoate (PubChem CID 135847271) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is ethyl 4-[2,5-dimethyl-3-[(Z)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]pyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[2,5-dimethyl-3-[(Z)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 135847271 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | ethyl 4-[2,5-dimethyl-3-[(Z)-[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)hydrazinylidene]methyl]pyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)cc(/C=N\Nc3nnc(C)c(=O)[nH]3)c2C)cc1 |
| InChI | InChI=1S/C20H22N6O3/c1-5-29-19(28)15-6-8-17(9-7-15)26-12(2)10-16(14(26)4)11-21-24-20-22-18(27)13(3)23-25-20/h6-11H,5H2,1-4H3,(H2,22,24,25,27)/b21-11- |
| InChIKey | ZHYGKMPSTDJUKX-NHDPSOOVSA-N |
| XLogP | 2.50 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|