C15H17N7O2 — CID 135824540
3-[(2Z)-2-[[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135824540) has the molecular formula C15H17N7O2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 3-[(2Z)-2-[[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2Z)-2-[[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135824540 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 3-[(2Z)-2-[[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1cc(-n2c(C)cc(/C=N\Nc3nnc(C)c(=O)[nH]3)c2C)no1 |
| InChI | InChI=1S/C15H17N7O2/c1-8-5-12(11(4)22(8)13-6-9(2)24-21-13)7-16-19-15-17-14(23)10(3)18-20-15/h5-7H,1-4H3,(H2,17,19,20,23)/b16-7- |
| InChIKey | YGEHNENXWXRUTL-APSNUPSMSA-N |
| XLogP | 1.62 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|