C19H19FN4O3 — CID 9146150
N-[(Z)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-2-(3-fluorophenoxy)acetamide (PubChem CID 9146150) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[(Z)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-2-(3-fluorophenoxy)acetamide.
| Compound Name | N-[(Z)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-2-(3-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 9146150 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[(Z)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-2-(3-fluorophenoxy)acetamide |
| SMILES | Cc1cc(-n2c(C)cc(/C=N\NC(=O)COc3cccc(F)c3)c2C)no1 |
| InChI | InChI=1S/C19H19FN4O3/c1-12-7-15(14(3)24(12)18-8-13(2)27-23-18)10-21-22-19(25)11-26-17-6-4-5-16(20)9-17/h4-10H,11H2,1-3H3,(H,22,25)/b21-10- |
| InChIKey | DTOPLRSJYMYHGH-FBHDLOMBSA-N |
| XLogP | 3.06 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|