C24H30N4O4 — CID 55364065
N-[(E)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-3-methoxy-4-(3-methylbutoxy)benzamide (PubChem CID 55364065) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[(E)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-3-methoxy-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[(E)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-3-methoxy-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 55364065 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[(E)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-3-methoxy-4-(3-methylbutoxy)benzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2cc(C)n(-c3cc(C)on3)c2C)ccc1OCCC(C)C |
| InChI | InChI=1S/C24H30N4O4/c1-15(2)9-10-31-21-8-7-19(13-22(21)30-6)24(29)26-25-14-20-11-16(3)28(18(20)5)23-12-17(4)32-27-23/h7-8,11-15H,9-10H2,1-6H3,(H,26,29)/b25-14+ |
| InChIKey | BNOSFTJXMGJSPW-AFUMVMLFSA-N |
| XLogP | 4.59 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|