C26H36N2O6 — CID 16556056
3,4,5-triethoxy-N-[(E)-[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]benzamide (PubChem CID 16556056) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(E)-[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(E)-[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 16556056 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 3,4,5-triethoxy-N-[(E)-[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2ccc(OCCC(C)C)c(OC)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H36N2O6/c1-7-31-23-15-20(16-24(32-8-2)25(23)33-9-3)26(29)28-27-17-19-10-11-21(22(14-19)30-6)34-13-12-18(4)5/h10-11,14-18H,7-9,12-13H2,1-6H3,(H,28,29)/b27-17+ |
| InChIKey | NTRAWEYSOJTGEJ-WPWMEQJKSA-N |
| XLogP | 5.08 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|