C16H16BrN5O2 — CID 8983346
4-bromo-N-[(Z)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 8983346) has the molecular formula C16H16BrN5O2 and a molecular weight of 390.24 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8983346 |
| Molecular Formula | C16H16BrN5O2 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 4-bromo-N-[(Z)-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc(-n2c(C)cc(/C=N\NC(=O)c3cc(Br)c[nH]3)c2C)no1 |
| InChI | InChI=1S/C16H16BrN5O2/c1-9-4-12(11(3)22(9)15-5-10(2)24-21-15)7-19-20-16(23)14-6-13(17)8-18-14/h4-8,18H,1-3H3,(H,20,23)/b19-7- |
| InChIKey | YYRBQDRHHWFAOV-GXHLCREISA-N |
| XLogP | 3.25 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|