C27H28N4O3 — CID 126203741
butyl 4-[3-[(Z)-[[(2R)-2-cyano-2-phenylacetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 126203741) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is butyl 4-[3-[(Z)-[[(2R)-2-cyano-2-phenylacetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | butyl 4-[3-[(Z)-[[(2R)-2-cyano-2-phenylacetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 126203741 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | butyl 4-[3-[(Z)-[[(2R)-2-cyano-2-phenylacetyl]hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-n2c(C)cc(/C=N\NC(=O)[C@@H](C#N)c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C27H28N4O3/c1-4-5-15-34-27(33)22-11-13-24(14-12-22)31-19(2)16-23(20(31)3)18-29-30-26(32)25(17-28)21-9-7-6-8-10-21/h6-14,16,18,25H,4-5,15H2,1-3H3,(H,30,32)/b29-18-/t25-/m0/s1 |
| InChIKey | HNCZAKRFYQMTKF-CIGKTAFOSA-N |
| XLogP | 4.81 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|