C22H19N5O3 — CID 126213837
(2R)-2-cyano-N-[(Z)-[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylideneamino]-2-phenylacetamide (PubChem CID 126213837) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is (2R)-2-cyano-N-[(Z)-[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylideneamino]-2-phenylacetamide.
| Compound Name | (2R)-2-cyano-N-[(Z)-[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 126213837 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (2R)-2-cyano-N-[(Z)-[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylideneamino]-2-phenylacetamide |
| SMILES | Cc1cc(/C=N\NC(=O)[C@@H](C#N)c2ccccc2)c(C)n1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H19N5O3/c1-15-11-18(16(2)26(15)19-9-6-10-20(12-19)27(29)30)14-24-25-22(28)21(13-23)17-7-4-3-5-8-17/h3-12,14,21H,1-2H3,(H,25,28)/b24-14-/t21-/m0/s1 |
| InChIKey | YZBSLBUUVMQAOV-ZJVWCJDDSA-N |
| XLogP | 3.76 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|