C25H30N2O4S — CID 126131558
butyl 4-[2,5-dimethyl-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoate (PubChem CID 126131558) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is butyl 4-[2,5-dimethyl-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoate.
| Compound Name | butyl 4-[2,5-dimethyl-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 126131558 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | butyl 4-[2,5-dimethyl-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(-n2c(C)cc(/C=C3\SC(=O)N(CC(C)C)C3=O)c2C)cc1 |
| InChI | InChI=1S/C25H30N2O4S/c1-6-7-12-31-24(29)19-8-10-21(11-9-19)27-17(4)13-20(18(27)5)14-22-23(28)26(15-16(2)3)25(30)32-22/h8-11,13-14,16H,6-7,12,15H2,1-5H3/b22-14- |
| InChIKey | DPYLADLOUPFUDD-HMAPJEAMSA-N |
| XLogP | 5.74 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|