C15H20N2O — CID 145362966
2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carbaldehyde;methanamine (PubChem CID 145362966) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carbaldehyde;methanamine.
| Compound Name | 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 145362966 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carbaldehyde;methanamine |
| SMILES | CN.Cc1ccc(-n2c(C)cc(C=O)c2C)cc1 |
| InChI | InChI=1S/C14H15NO.CH5N/c1-10-4-6-14(7-5-10)15-11(2)8-13(9-16)12(15)3;1-2/h4-9H,1-3H3;2H2,1H3 |
| InChIKey | BHSFXHXLBJBPET-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|