C13H14N2O2 — CID 24694826
1-(6-methoxy-3-pyridinyl)-2,5-dimethylpyrrole-3-carbaldehyde (PubChem CID 24694826) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-(6-methoxy-3-pyridinyl)-2,5-dimethylpyrrole-3-carbaldehyde.
| Compound Name | 1-(6-methoxy-3-pyridinyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 24694826 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-(6-methoxy-3-pyridinyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| SMILES | COc1ccc(-n2c(C)cc(C=O)c2C)cn1 |
| InChI | InChI=1S/C13H14N2O2/c1-9-6-11(8-16)10(2)15(9)12-4-5-13(17-3)14-7-12/h4-8H,1-3H3 |
| InChIKey | QTLQOEMMEULMSI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|