C31H30N2O7 — CID 126065952
methyl (4Z)-1-(4-ethoxycarbonylphenyl)-4-[[1-(2-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126065952) has the molecular formula C31H30N2O7 and a molecular weight of 542.59 g/mol. Its IUPAC name is methyl (4Z)-1-(4-ethoxycarbonylphenyl)-4-[[1-(2-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-(4-ethoxycarbonylphenyl)-4-[[1-(2-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126065952 |
| Molecular Formula | C31H30N2O7 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | methyl (4Z)-1-(4-ethoxycarbonylphenyl)-4-[[1-(2-methoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)/C(=C\c3cc(C)n(-c4ccccc4C(=O)OC)c3C)C(C(=O)OC)=C2C)cc1 |
| InChI | InChI=1S/C31H30N2O7/c1-7-40-29(35)21-12-14-23(15-13-21)33-20(4)27(31(37)39-6)25(28(33)34)17-22-16-18(2)32(19(22)3)26-11-9-8-10-24(26)30(36)38-5/h8-17H,7H2,1-6H3/b25-17- |
| InChIKey | SDOIOKXHYCFCKN-UQQQWYQISA-N |
| XLogP | 4.93 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|