C23H24N2O3 — CID 126192654
3-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylbenzoic acid (PubChem CID 126192654) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylbenzoic acid.
| Compound Name | 3-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 126192654 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-[[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methylbenzoic acid |
| SMILES | CCOc1ccc(-n2c(C)cc(/C=N/c3cccc(C(=O)O)c3C)c2C)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-5-28-20-11-9-19(10-12-20)25-15(2)13-18(17(25)4)14-24-22-8-6-7-21(16(22)3)23(26)27/h6-14H,5H2,1-4H3,(H,26,27)/b24-14+ |
| InChIKey | BQFSGSTYWDCDLO-ZVHZXABRSA-N |
| XLogP | 5.25 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|