C26H30N4O3 — CID 94837316
N'-[(E)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(2-phenylethyl)propanediamide (PubChem CID 94837316) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is N'-[(E)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(2-phenylethyl)propanediamide.
| Compound Name | N'-[(E)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 94837316 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | N'-[(E)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(2-phenylethyl)propanediamide |
| SMILES | CCOc1ccc(-n2c(C)cc(/C=N/NC(=O)CC(=O)NCCc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C26H30N4O3/c1-4-33-24-12-10-23(11-13-24)30-19(2)16-22(20(30)3)18-28-29-26(32)17-25(31)27-15-14-21-8-6-5-7-9-21/h5-13,16,18H,4,14-15,17H2,1-3H3,(H,27,31)(H,29,32)/b28-18+ |
| InChIKey | VIBHVYPCRVFSAK-MTDXEUNCSA-N |
| XLogP | 3.69 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|