C24H24N4O4 — CID 133240938
4-[2,5-dimethyl-3-[(Z)-[[2-oxo-2-(2-phenylethylamino)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoic acid (PubChem CID 133240938) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-[2,5-dimethyl-3-[(Z)-[[2-oxo-2-(2-phenylethylamino)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoic acid.
| Compound Name | 4-[2,5-dimethyl-3-[(Z)-[[2-oxo-2-(2-phenylethylamino)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 133240938 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-[2,5-dimethyl-3-[(Z)-[[2-oxo-2-(2-phenylethylamino)acetyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoic acid |
| SMILES | Cc1cc(/C=N\NC(=O)C(=O)NCCc2ccccc2)c(C)n1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H24N4O4/c1-16-14-20(17(2)28(16)21-10-8-19(9-11-21)24(31)32)15-26-27-23(30)22(29)25-13-12-18-6-4-3-5-7-18/h3-11,14-15H,12-13H2,1-2H3,(H,25,29)(H,27,30)(H,31,32)/b26-15- |
| InChIKey | IHFVJNIZYYIETP-YSMPRRRNSA-N |
| XLogP | 2.60 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|